C22H33N3 — CID 154218779
N'-[2-(2,4,6-trimethyl-N-(2,4,6-trimethylphenyl)anilino)ethyl]ethane-1,2-diamine (PubChem CID 154218779) has the molecular formula C22H33N3 and a molecular weight of 339.53 g/mol. Its IUPAC name is N'-[2-(2,4,6-trimethyl-N-(2,4,6-trimethylphenyl)anilino)ethyl]ethane-1,2-diamine.
| Compound Name | N'-[2-(2,4,6-trimethyl-N-(2,4,6-trimethylphenyl)anilino)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 154218779 |
| Molecular Formula | C22H33N3 |
| Molecular Weight | 339.53 g/mol |
| Exact Mass | 339.27 |
| IUPAC Name | N'-[2-(2,4,6-trimethyl-N-(2,4,6-trimethylphenyl)anilino)ethyl]ethane-1,2-diamine |
| SMILES | Cc1cc(C)c(N(CCNCCN)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C22H33N3/c1-15-11-17(3)21(18(4)12-15)25(10-9-24-8-7-23)22-19(5)13-16(2)14-20(22)6/h11-14,24H,7-10,23H2,1-6H3 |
| InChIKey | GTOKTRAYKQGUEH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.53 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|