C7H10N4O5 — CID 15422151
methyl (2E,3E)-3-(carbamoylhydrazinylidene)-2-(nitromethylidene)butanoate (PubChem CID 15422151) has the molecular formula C7H10N4O5 and a molecular weight of 230.18 g/mol. Its IUPAC name is methyl (2E,3E)-3-(carbamoylhydrazinylidene)-2-(nitromethylidene)butanoate.
| Compound Name | methyl (2E,3E)-3-(carbamoylhydrazinylidene)-2-(nitromethylidene)butanoate |
|---|---|
| PubChem CID | 15422151 |
| Molecular Formula | C7H10N4O5 |
| Molecular Weight | 230.18 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | methyl (2E,3E)-3-(carbamoylhydrazinylidene)-2-(nitromethylidene)butanoate |
| SMILES | COC(=O)C(=C/[N+](=O)[O-])/C(C)=N/NC(N)=O |
| InChI | InChI=1S/C7H10N4O5/c1-4(9-10-7(8)13)5(3-11(14)15)6(12)16-2/h3H,1-2H3,(H3,8,10,13)/b5-3+,9-4+ |
| InChIKey | SPUMWRCUZRDGPP-BMVOEDMYSA-N |
| XLogP | -0.64 |
| TPSA | 136.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.18 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|