C10H16N2O3 — CID 72585951
methyl 4-(acetylhydrazinylidene)-2,3-dimethylpent-2-enoate (PubChem CID 72585951) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is methyl 4-(acetylhydrazinylidene)-2,3-dimethylpent-2-enoate.
| Compound Name | methyl 4-(acetylhydrazinylidene)-2,3-dimethylpent-2-enoate |
|---|---|
| PubChem CID | 72585951 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | methyl 4-(acetylhydrazinylidene)-2,3-dimethylpent-2-enoate |
| SMILES | COC(=O)C(C)=C(C)C(C)=NNC(C)=O |
| InChI | InChI=1S/C10H16N2O3/c1-6(7(2)10(14)15-5)8(3)11-12-9(4)13/h1-5H3,(H,12,13) |
| InChIKey | HPAISXFTALWZCU-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|