C18H12N2O3S — CID 154222827
2-phenyl-1,7-phenanthroline-6-sulfonic acid (PubChem CID 154222827) has the molecular formula C18H12N2O3S and a molecular weight of 336.37 g/mol. Its IUPAC name is 2-phenyl-1,7-phenanthroline-6-sulfonic acid.
| Compound Name | 2-phenyl-1,7-phenanthroline-6-sulfonic acid |
|---|---|
| PubChem CID | 154222827 |
| Molecular Formula | C18H12N2O3S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 2-phenyl-1,7-phenanthroline-6-sulfonic acid |
| SMILES | O=S(=O)(O)c1cc2ccc(-c3ccccc3)nc2c2cccnc12 |
| InChI | InChI=1S/C18H12N2O3S/c21-24(22,23)16-11-13-8-9-15(12-5-2-1-3-6-12)20-17(13)14-7-4-10-19-18(14)16/h1-11H,(H,21,22,23) |
| InChIKey | JDEUTQGSYSJMHJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|