C44H26N4O4 — CID 118448725
phenyl 9-[3-(6-phenoxycarbonyl-1,10-phenanthrolin-2-yl)phenyl]-1,10-phenanthroline-5-carboxylate (PubChem CID 118448725) has the molecular formula C44H26N4O4 and a molecular weight of 674.72 g/mol. Its IUPAC name is phenyl 9-[3-(6-phenoxycarbonyl-1,10-phenanthrolin-2-yl)phenyl]-1,10-phenanthroline-5-carboxylate.
| Compound Name | phenyl 9-[3-(6-phenoxycarbonyl-1,10-phenanthrolin-2-yl)phenyl]-1,10-phenanthroline-5-carboxylate |
|---|---|
| PubChem CID | 118448725 |
| Molecular Formula | C44H26N4O4 |
| Molecular Weight | 674.72 g/mol |
| Exact Mass | 674.20 |
| IUPAC Name | phenyl 9-[3-(6-phenoxycarbonyl-1,10-phenanthrolin-2-yl)phenyl]-1,10-phenanthroline-5-carboxylate |
| SMILES | O=C(Oc1ccccc1)c1cc2ccc(-c3cccc(-c4ccc5cc(C(=O)Oc6ccccc6)c6cccnc6c5n4)c3)nc2c2ncccc12 |
| InChI | InChI=1S/C44H26N4O4/c49-43(51-31-12-3-1-4-13-31)35-25-29-18-20-37(47-39(29)41-33(35)16-8-22-45-41)27-10-7-11-28(24-27)38-21-19-30-26-36(44(50)52-32-14-5-2-6-15-32)34-17-9-23-46-42(34)40(30)48-38/h1-26H |
| InChIKey | TXMDWFMYHMOCKP-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 104.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.72 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|