C31H21N4O3P — CID 118445475
[9-[3-(6-methyl-1,10-phenanthrolin-2-yl)phenyl]-1,10-phenanthrolin-5-yl]phosphonic acid (PubChem CID 118445475) has the molecular formula C31H21N4O3P and a molecular weight of 528.51 g/mol. Its IUPAC name is [9-[3-(6-methyl-1,10-phenanthrolin-2-yl)phenyl]-1,10-phenanthrolin-5-yl]phosphonic acid.
| Compound Name | [9-[3-(6-methyl-1,10-phenanthrolin-2-yl)phenyl]-1,10-phenanthrolin-5-yl]phosphonic acid |
|---|---|
| PubChem CID | 118445475 |
| Molecular Formula | C31H21N4O3P |
| Molecular Weight | 528.51 g/mol |
| Exact Mass | 528.14 |
| IUPAC Name | [9-[3-(6-methyl-1,10-phenanthrolin-2-yl)phenyl]-1,10-phenanthrolin-5-yl]phosphonic acid |
| SMILES | Cc1cc2ccc(-c3cccc(-c4ccc5cc(P(=O)(O)O)c6cccnc6c5n4)c3)nc2c2ncccc12 |
| InChI | InChI=1S/C31H21N4O3P/c1-18-15-21-9-11-25(34-28(21)30-23(18)7-3-13-32-30)19-5-2-6-20(16-19)26-12-10-22-17-27(39(36,37)38)24-8-4-14-33-31(24)29(22)35-26/h2-17H,1H3,(H2,36,37,38) |
| InChIKey | ZQPYJIRNSXRNPL-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 109.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.51 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|