C37H23N7 — CID 158047088
6-(2,6-dipyridin-2-yl-4-pyridinyl)-2-(4-pyrimidin-2-ylphenyl)-1,10-phenanthroline (PubChem CID 158047088) has the molecular formula C37H23N7 and a molecular weight of 565.64 g/mol. Its IUPAC name is 6-(2,6-dipyridin-2-yl-4-pyridinyl)-2-(4-pyrimidin-2-ylphenyl)-1,10-phenanthroline.
| Compound Name | 6-(2,6-dipyridin-2-yl-4-pyridinyl)-2-(4-pyrimidin-2-ylphenyl)-1,10-phenanthroline |
|---|---|
| PubChem CID | 158047088 |
| Molecular Formula | C37H23N7 |
| Molecular Weight | 565.64 g/mol |
| Exact Mass | 565.20 |
| IUPAC Name | 6-(2,6-dipyridin-2-yl-4-pyridinyl)-2-(4-pyrimidin-2-ylphenyl)-1,10-phenanthroline |
| SMILES | c1ccc(-c2cc(-c3cc4ccc(-c5ccc(-c6ncccn6)cc5)nc4c4ncccc34)cc(-c3ccccn3)n2)nc1 |
| InChI | InChI=1S/C37H23N7/c1-3-16-38-31(8-1)33-22-27(23-34(43-33)32-9-2-4-17-39-32)29-21-26-14-15-30(44-35(26)36-28(29)7-5-18-40-36)24-10-12-25(13-11-24)37-41-19-6-20-42-37/h1-23H |
| InChIKey | FJAXMFMCGYHMRY-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 90.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.64 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|