C15H24N2O5 — CID 154223641
4-[2-ethoxy-2-oxo-1-(4-oxopiperidin-1-yl)ethyl]piperidine-1-carboxylic acid (PubChem CID 154223641) has the molecular formula C15H24N2O5 and a molecular weight of 312.37 g/mol. Its IUPAC name is 4-[2-ethoxy-2-oxo-1-(4-oxopiperidin-1-yl)ethyl]piperidine-1-carboxylic acid.
| Compound Name | 4-[2-ethoxy-2-oxo-1-(4-oxopiperidin-1-yl)ethyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 154223641 |
| Molecular Formula | C15H24N2O5 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 4-[2-ethoxy-2-oxo-1-(4-oxopiperidin-1-yl)ethyl]piperidine-1-carboxylic acid |
| SMILES | CCOC(=O)C(C1CCN(C(=O)O)CC1)N1CCC(=O)CC1 |
| InChI | InChI=1S/C15H24N2O5/c1-2-22-14(19)13(16-9-5-12(18)6-10-16)11-3-7-17(8-4-11)15(20)21/h11,13H,2-10H2,1H3,(H,20,21) |
| InChIKey | AOAPJWQDLMPBKG-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |