About 2-(diazomethoxy)phenol
2-(diazomethoxy)phenol (PubChem CID 154231053) has the molecular formula C7H6N2O2
and a molecular weight of 150.14 g/mol. Its IUPAC name is 2-(diazomethoxy)phenol.
Molecular Properties
| Compound Name | 2-(diazomethoxy)phenol |
| PubChem CID | 154231053 |
| Molecular Formula | C7H6N2O2 |
| Molecular Weight | 150.14 g/mol |
| Exact Mass | 150.04 |
| IUPAC Name | 2-(diazomethoxy)phenol |
| SMILES | [N-]=[N+]=COc1ccccc1O |
| InChI | InChI=1S/C7H6N2O2/c8-9-5-11-7-4-2-1-3-6(7)10/h1-5,10H |
| InChIKey | LYDVWYSWOJNBMG-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 65.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.14 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-(diazomethoxy)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diazomethoxy)phenol?
The IUPAC name of 2-(diazomethoxy)phenol (CID 154231053) is 2-(diazomethoxy)phenol.
What is the SMILES notation for 2-(diazomethoxy)phenol?
The canonical SMILES for 2-(diazomethoxy)phenol is [N-]=[N+]=COc1ccccc1O.
What is the InChIKey of 2-(diazomethoxy)phenol?
The InChIKey is LYDVWYSWOJNBMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O2/c8-9-5-11-7-4-2-1-3-6(7)10/h1-5,10H.
What are the key properties of 2-(diazomethoxy)phenol?
2-(diazomethoxy)phenol has a molecular weight of 150.14 g/mol, XLogP of 1.03, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diazomethoxy)phenol is sourced from PubChem (CID 154231053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).