C9H10N4O2 — CID 154238866
3,5,9,10-tetrazatricyclo[7.4.0.02,7]trideca-1,12-diene-4,6-dione (PubChem CID 154238866) has the molecular formula C9H10N4O2 and a molecular weight of 206.20 g/mol. Its IUPAC name is 3,5,9,10-tetrazatricyclo[7.4.0.02,7]trideca-1,12-diene-4,6-dione.
| Compound Name | 3,5,9,10-tetrazatricyclo[7.4.0.02,7]trideca-1,12-diene-4,6-dione |
|---|---|
| PubChem CID | 154238866 |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 3,5,9,10-tetrazatricyclo[7.4.0.02,7]trideca-1,12-diene-4,6-dione |
| SMILES | O=C1NC(=O)C2CN3NCC=CC3=C2N1 |
| InChI | InChI=1S/C9H10N4O2/c14-8-5-4-13-6(2-1-3-10-13)7(5)11-9(15)12-8/h1-2,5,10H,3-4H2,(H2,11,12,14,15) |
| InChIKey | ZKCIFZFYUNGIMS-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |