C9H9N3O2 — CID 141415579
1,4a,5,7-tetrahydropyrimido[4,5-a]pyrrolizine-2,4-dione (PubChem CID 141415579) has the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. Its IUPAC name is 1,4a,5,7-tetrahydropyrimido[4,5-a]pyrrolizine-2,4-dione.
| Compound Name | 1,4a,5,7-tetrahydropyrimido[4,5-a]pyrrolizine-2,4-dione |
|---|---|
| PubChem CID | 141415579 |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 1,4a,5,7-tetrahydropyrimido[4,5-a]pyrrolizine-2,4-dione |
| SMILES | O=C1NC(=O)C2CN3CC=CC3=C2N1 |
| InChI | InChI=1S/C9H9N3O2/c13-8-5-4-12-3-1-2-6(12)7(5)10-9(14)11-8/h1-2,5H,3-4H2,(H2,10,11,13,14) |
| InChIKey | HVKKOKFFDRQDAY-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |