C10H11N3O2 — CID 141415558
4a,5,7,8-tetrahydro-1H-pyrimido[4,5-a]indolizine-2,4-dione (PubChem CID 141415558) has the molecular formula C10H11N3O2 and a molecular weight of 205.22 g/mol. Its IUPAC name is 4a,5,7,8-tetrahydro-1H-pyrimido[4,5-a]indolizine-2,4-dione.
| Compound Name | 4a,5,7,8-tetrahydro-1H-pyrimido[4,5-a]indolizine-2,4-dione |
|---|---|
| PubChem CID | 141415558 |
| Molecular Formula | C10H11N3O2 |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | 4a,5,7,8-tetrahydro-1H-pyrimido[4,5-a]indolizine-2,4-dione |
| SMILES | O=C1NC(=O)C2CN3CCC=CC3=C2N1 |
| InChI | InChI=1S/C10H11N3O2/c14-9-6-5-13-4-2-1-3-7(13)8(6)11-10(15)12-9/h1,3,6H,2,4-5H2,(H2,11,12,14,15) |
| InChIKey | MITWGSWRYZRFFO-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |