C13H24N4O2 — CID 166112620
1-[(1E,3Z)-1,4-diamino-5-methylhexa-1,3-dien-2-yl]-1,3-diazinane-2,4-dione;ethane (PubChem CID 166112620) has the molecular formula C13H24N4O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 1-[(1E,3Z)-1,4-diamino-5-methylhexa-1,3-dien-2-yl]-1,3-diazinane-2,4-dione;ethane.
| Compound Name | 1-[(1E,3Z)-1,4-diamino-5-methylhexa-1,3-dien-2-yl]-1,3-diazinane-2,4-dione;ethane |
|---|---|
| PubChem CID | 166112620 |
| Molecular Formula | C13H24N4O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 1-[(1E,3Z)-1,4-diamino-5-methylhexa-1,3-dien-2-yl]-1,3-diazinane-2,4-dione;ethane |
| SMILES | CC.CC(C)/C(N)=C/C(=C\N)N1CCC(=O)NC1=O |
| InChI | InChI=1S/C11H18N4O2.C2H6/c1-7(2)9(13)5-8(6-12)15-4-3-10(16)14-11(15)17;1-2/h5-7H,3-4,12-13H2,1-2H3,(H,14,16,17);1-2H3/b8-6+,9-5-; |
| InChIKey | KWCAUQMNEDLTMD-SCAINISCSA-N |
| XLogP | 1.25 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|