C14H23N7O2 — CID 123225761
N-[3-(diaminomethylideneamino)propyl]-3-(6-methyl-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl)propanamide (PubChem CID 123225761) has the molecular formula C14H23N7O2 and a molecular weight of 321.39 g/mol. Its IUPAC name is N-[3-(diaminomethylideneamino)propyl]-3-(6-methyl-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl)propanamide.
| Compound Name | N-[3-(diaminomethylideneamino)propyl]-3-(6-methyl-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl)propanamide |
|---|---|
| PubChem CID | 123225761 |
| Molecular Formula | C14H23N7O2 |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | N-[3-(diaminomethylideneamino)propyl]-3-(6-methyl-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl)propanamide |
| SMILES | CC1=CC2=CN(CCC(=O)NCCCN=C(N)N)C(=O)NC2N1 |
| InChI | InChI=1S/C14H23N7O2/c1-9-7-10-8-21(14(23)20-12(10)19-9)6-3-11(22)17-4-2-5-18-13(15)16/h7-8,12,19H,2-6H2,1H3,(H,17,22)(H,20,23)(H4,15,16,18) |
| InChIKey | GEQCKYUINWJGKY-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 137.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|