C18H29N7O — CID 123470606
2-[3-[5-(6-methyl-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl)hepta-3,5-dienylamino]propyl]guanidine (PubChem CID 123470606) has the molecular formula C18H29N7O and a molecular weight of 359.48 g/mol. Its IUPAC name is 2-[3-[5-(6-methyl-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl)hepta-3,5-dienylamino]propyl]guanidine.
| Compound Name | 2-[3-[5-(6-methyl-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl)hepta-3,5-dienylamino]propyl]guanidine |
|---|---|
| PubChem CID | 123470606 |
| Molecular Formula | C18H29N7O |
| Molecular Weight | 359.48 g/mol |
| Exact Mass | 359.24 |
| IUPAC Name | 2-[3-[5-(6-methyl-2-oxo-7,7a-dihydro-1H-pyrrolo[2,3-d]pyrimidin-3-yl)hepta-3,5-dienylamino]propyl]guanidine |
| SMILES | CC=C(C=CCCNCCCN=C(N)N)N1C=C2C=C(C)NC2NC1=O |
| InChI | InChI=1S/C18H29N7O/c1-3-15(7-4-5-8-21-9-6-10-22-17(19)20)25-12-14-11-13(2)23-16(14)24-18(25)26/h3-4,7,11-12,16,21,23H,5-6,8-10H2,1-2H3,(H,24,26)(H4,19,20,22) |
| InChIKey | LMJIUWAKAYTNIH-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 120.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.48 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|