C14H26N2O2 — CID 177003125
ethane;1-[(3E)-hexa-1,3-dien-3-yl]-1,3-diazinane-2,4-dione (PubChem CID 177003125) has the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. Its IUPAC name is ethane;1-[(3E)-hexa-1,3-dien-3-yl]-1,3-diazinane-2,4-dione.
| Compound Name | ethane;1-[(3E)-hexa-1,3-dien-3-yl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 177003125 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | ethane;1-[(3E)-hexa-1,3-dien-3-yl]-1,3-diazinane-2,4-dione |
| SMILES | C=C/C(=C\CC)N1CCC(=O)NC1=O.CC.CC |
| InChI | InChI=1S/C10H14N2O2.2C2H6/c1-3-5-8(4-2)12-7-6-9(13)11-10(12)14;2*1-2/h4-5H,2-3,6-7H2,1H3,(H,11,13,14);2*1-2H3/b8-5+;; |
| InChIKey | OLUPNMRQCZJHMI-RMZRELHQSA-N |
| XLogP | 3.46 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|