C16H26O13Si8 — CID 15423899
2-[3,5,7,9,11,13,15-heptakis(ethenyl)-2,4,6,8,10,12,14,16,17,18,19,20-dodecaoxa-1,3,5,7,9,11,13,15-octasilapentacyclo[9.5.1.13,9.15,15.17,13]icosan-1-yl]ethanol (PubChem CID 15423899) has the molecular formula C16H26O13Si8 and a molecular weight of 651.06 g/mol. Its IUPAC name is 2-[3,5,7,9,11,13,15-heptakis(ethenyl)-2,4,6,8,10,12,14,16,17,18,19,20-dodecaoxa-1,3,5,7,9,11,13,15-octasilapentacyclo[9.5.1.13,9.15,15.17,13]icosan-1-yl]ethanol.
| Compound Name | 2-[3,5,7,9,11,13,15-heptakis(ethenyl)-2,4,6,8,10,12,14,16,17,18,19,20-dodecaoxa-1,3,5,7,9,11,13,15-octasilapentacyclo[9.5.1.13,9.15,15.17,13]icosan-1-yl]ethanol |
|---|---|
| PubChem CID | 15423899 |
| Molecular Formula | C16H26O13Si8 |
| Molecular Weight | 651.06 g/mol |
| Exact Mass | 649.95 |
| IUPAC Name | 2-[3,5,7,9,11,13,15-heptakis(ethenyl)-2,4,6,8,10,12,14,16,17,18,19,20-dodecaoxa-1,3,5,7,9,11,13,15-octasilapentacyclo[9.5.1.13,9.15,15.17,13]icosan-1-yl]ethanol |
| SMILES | C=C[Si]12O[Si]3(C=C)O[Si]4(C=C)O[Si](C=C)(O1)O[Si]1(C=C)O[Si](C=C)(O2)O[Si](C=C)(O3)O[Si](CCO)(O4)O1 |
| InChI | InChI=1S/C16H26O13Si8/c1-8-30-18-31(9-2)21-34(12-5)23-32(10-3,19-30)25-36(14-7)26-33(11-4,20-30)24-35(13-6,22-31)28-37(27-34,29-36)16-15-17/h8-14,17H,1-7,15-16H2 |
| InChIKey | UGSZZPXPSAWKQT-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 130.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.06 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|