C18H30O3Si3 — CID 175565406
2,2,4,4-tetrakis(ethenyl)-6,6-bis(3-methylbut-2-en-2-yl)-1,3,5,2,4,6-trioxatrisilinane (PubChem CID 175565406) has the molecular formula C18H30O3Si3 and a molecular weight of 378.69 g/mol. Its IUPAC name is 2,2,4,4-tetrakis(ethenyl)-6,6-bis(3-methylbut-2-en-2-yl)-1,3,5,2,4,6-trioxatrisilinane.
| Compound Name | 2,2,4,4-tetrakis(ethenyl)-6,6-bis(3-methylbut-2-en-2-yl)-1,3,5,2,4,6-trioxatrisilinane |
|---|---|
| PubChem CID | 175565406 |
| Molecular Formula | C18H30O3Si3 |
| Molecular Weight | 378.69 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 2,2,4,4-tetrakis(ethenyl)-6,6-bis(3-methylbut-2-en-2-yl)-1,3,5,2,4,6-trioxatrisilinane |
| SMILES | C=C[Si]1(C=C)O[Si](C=C)(C=C)O[Si](C(C)=C(C)C)(C(C)=C(C)C)O1 |
| InChI | InChI=1S/C18H30O3Si3/c1-11-22(12-2)19-23(13-3,14-4)21-24(20-22,17(9)15(5)6)18(10)16(7)8/h11-14H,1-4H2,5-10H3 |
| InChIKey | CSXBPHMKEIOPAV-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.69 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|