C17H33NO5Si4 — CID 174954025
cyanic acid;2,2,4,4-tetrakis(ethenyl)-6,6,8,8-tetraethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 174954025) has the molecular formula C17H33NO5Si4 and a molecular weight of 443.80 g/mol. Its IUPAC name is cyanic acid;2,2,4,4-tetrakis(ethenyl)-6,6,8,8-tetraethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | cyanic acid;2,2,4,4-tetrakis(ethenyl)-6,6,8,8-tetraethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 174954025 |
| Molecular Formula | C17H33NO5Si4 |
| Molecular Weight | 443.80 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | cyanic acid;2,2,4,4-tetrakis(ethenyl)-6,6,8,8-tetraethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | C=C[Si]1(C=C)O[Si](C=C)(C=C)O[Si](CC)(CC)O[Si](CC)(CC)O1.N#CO |
| InChI | InChI=1S/C16H32O4Si4.CHNO/c1-9-21(10-2)17-22(11-3,12-4)19-24(15-7,16-8)20-23(13-5,14-6)18-21;2-1-3/h9-12H,1-4,13-16H2,5-8H3;3H |
| InChIKey | GTAAFXHTEYETLV-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 80.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.80 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|