C15H16O4Se — CID 15424471
trans-methyl (1S,2S)-5-oxo-2-phenylselanylcarbonylcyclohexane-1-carboxylate (PubChem CID 15424471) has the molecular formula C15H16O4Se and a molecular weight of 339.25 g/mol. Its IUPAC name is trans-methyl (1S,2S)-5-oxo-2-phenylselanylcarbonylcyclohexane-1-carboxylate.
| Compound Name | trans-methyl (1S,2S)-5-oxo-2-phenylselanylcarbonylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 15424471 |
| Molecular Formula | C15H16O4Se |
| Molecular Weight | 339.25 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | trans-methyl (1S,2S)-5-oxo-2-phenylselanylcarbonylcyclohexane-1-carboxylate |
| SMILES | COC(=O)[C@H]1CC(=O)CC[C@@H]1C(=O)[Se]c1ccccc1 |
| InChI | InChI=1S/C15H16O4Se/c1-19-14(17)13-9-10(16)7-8-12(13)15(18)20-11-5-3-2-4-6-11/h2-6,12-13H,7-9H2,1H3/t12-,13-/m0/s1 |
| InChIKey | RYZGLENEJIMASI-STQMWFEESA-N |
| XLogP | 0.70 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.25 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|