C23H22F3N2O3- — CID 154246446
4-phenyl-4-[[5-(trifluoromethyl)-1H-indol-7-yl]methoxymethyl]piperidine-1-carboxylate (PubChem CID 154246446) has the molecular formula C23H22F3N2O3- and a molecular weight of 431.43 g/mol. Its IUPAC name is 4-phenyl-4-[[5-(trifluoromethyl)-1H-indol-7-yl]methoxymethyl]piperidine-1-carboxylate.
| Compound Name | 4-phenyl-4-[[5-(trifluoromethyl)-1H-indol-7-yl]methoxymethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 154246446 |
| Molecular Formula | C23H22F3N2O3- |
| Molecular Weight | 431.43 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 4-phenyl-4-[[5-(trifluoromethyl)-1H-indol-7-yl]methoxymethyl]piperidine-1-carboxylate |
| SMILES | O=C([O-])N1CCC(COCc2cc(C(F)(F)F)cc3cc[nH]c23)(c2ccccc2)CC1 |
| InChI | InChI=1S/C23H23F3N2O3/c24-23(25,26)19-12-16-6-9-27-20(16)17(13-19)14-31-15-22(18-4-2-1-3-5-18)7-10-28(11-8-22)21(29)30/h1-6,9,12-13,27H,7-8,10-11,14-15H2,(H,29,30)/p-1 |
| InChIKey | XBRFKPNVAFKKJD-UHFFFAOYSA-M |
| XLogP | 4.08 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |