C38H30N2O3 — CID 154249062
3-(1,2-diphenylindolizin-3-yl)-3-(4-morpholin-4-ylphenyl)-2-benzofuran-1-one (PubChem CID 154249062) has the molecular formula C38H30N2O3 and a molecular weight of 562.67 g/mol. Its IUPAC name is 3-(1,2-diphenylindolizin-3-yl)-3-(4-morpholin-4-ylphenyl)-2-benzofuran-1-one.
| Compound Name | 3-(1,2-diphenylindolizin-3-yl)-3-(4-morpholin-4-ylphenyl)-2-benzofuran-1-one |
|---|---|
| PubChem CID | 154249062 |
| Molecular Formula | C38H30N2O3 |
| Molecular Weight | 562.67 g/mol |
| Exact Mass | 562.23 |
| IUPAC Name | 3-(1,2-diphenylindolizin-3-yl)-3-(4-morpholin-4-ylphenyl)-2-benzofuran-1-one |
| SMILES | O=C1OC(c2ccc(N3CCOCC3)cc2)(c2c(-c3ccccc3)c(-c3ccccc3)c3ccccn23)c2ccccc21 |
| InChI | InChI=1S/C38H30N2O3/c41-37-31-15-7-8-16-32(31)38(43-37,29-18-20-30(21-19-29)39-23-25-42-26-24-39)36-35(28-13-5-2-6-14-28)34(27-11-3-1-4-12-27)33-17-9-10-22-40(33)36/h1-22H,23-26H2 |
| InChIKey | GGDPPRISBYFZIU-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.67 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |