C19H18F3NO2 — CID 154255503
3-[2-[3-[3-(trifluoromethyl)phenyl]prop-2-enylamino]phenyl]propanoic acid (PubChem CID 154255503) has the molecular formula C19H18F3NO2 and a molecular weight of 349.35 g/mol. Its IUPAC name is 3-[2-[3-[3-(trifluoromethyl)phenyl]prop-2-enylamino]phenyl]propanoic acid.
| Compound Name | 3-[2-[3-[3-(trifluoromethyl)phenyl]prop-2-enylamino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 154255503 |
| Molecular Formula | C19H18F3NO2 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 3-[2-[3-[3-(trifluoromethyl)phenyl]prop-2-enylamino]phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccccc1NCC=Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C19H18F3NO2/c20-19(21,22)16-8-3-5-14(13-16)6-4-12-23-17-9-2-1-7-15(17)10-11-18(24)25/h1-9,13,23H,10-12H2,(H,24,25) |
| InChIKey | VHSKNRLGMHCSAF-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |