C18H15ClF3NO2 — CID 66553534
[(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enyl] N-[2-(chloromethyl)phenyl]carbamate (PubChem CID 66553534) has the molecular formula C18H15ClF3NO2 and a molecular weight of 369.77 g/mol. Its IUPAC name is [(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enyl] N-[2-(chloromethyl)phenyl]carbamate.
| Compound Name | [(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enyl] N-[2-(chloromethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 66553534 |
| Molecular Formula | C18H15ClF3NO2 |
| Molecular Weight | 369.77 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | [(E)-3-[3-(trifluoromethyl)phenyl]prop-2-enyl] N-[2-(chloromethyl)phenyl]carbamate |
| SMILES | O=C(Nc1ccccc1CCl)OC/C=C/c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H15ClF3NO2/c19-12-14-7-1-2-9-16(14)23-17(24)25-10-4-6-13-5-3-8-15(11-13)18(20,21)22/h1-9,11H,10,12H2,(H,23,24)/b6-4+ |
| InChIKey | DICHPWMRQZCBAP-GQCTYLIASA-N |
| XLogP | 5.71 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.77 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|