C18H17F3N2O — CID 154260124
2-[3-(azetidin-1-ylmethyl)-5-(trifluoromethyl)phenyl]benzamide (PubChem CID 154260124) has the molecular formula C18H17F3N2O and a molecular weight of 334.34 g/mol. Its IUPAC name is 2-[3-(azetidin-1-ylmethyl)-5-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 2-[3-(azetidin-1-ylmethyl)-5-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 154260124 |
| Molecular Formula | C18H17F3N2O |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 2-[3-(azetidin-1-ylmethyl)-5-(trifluoromethyl)phenyl]benzamide |
| SMILES | NC(=O)c1ccccc1-c1cc(CN2CCC2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H17F3N2O/c19-18(20,21)14-9-12(11-23-6-3-7-23)8-13(10-14)15-4-1-2-5-16(15)17(22)24/h1-2,4-5,8-10H,3,6-7,11H2,(H2,22,24) |
| InChIKey | AFXGLGWQNNRDBK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |