C12H20ClNS — CID 154268939
1-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-3-chloropropane-1-thione (PubChem CID 154268939) has the molecular formula C12H20ClNS and a molecular weight of 245.82 g/mol. Its IUPAC name is 1-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-3-chloropropane-1-thione.
| Compound Name | 1-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-3-chloropropane-1-thione |
|---|---|
| PubChem CID | 154268939 |
| Molecular Formula | C12H20ClNS |
| Molecular Weight | 245.82 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 1-[(4aS,8aS)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]-3-chloropropane-1-thione |
| SMILES | S=C(CCCl)N1CCC[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C12H20ClNS/c13-8-7-12(15)14-9-3-5-10-4-1-2-6-11(10)14/h10-11H,1-9H2/t10-,11-/m0/s1 |
| InChIKey | IWVVNECNSFETIY-QWRGUYRKSA-N |
| XLogP | 3.60 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.82 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|