C3H5Cl3N2O3S — CID 154279468
2,2,2-trichloroethylsulfonylurea (PubChem CID 154279468) has the molecular formula C3H5Cl3N2O3S and a molecular weight of 255.51 g/mol. Its IUPAC name is 2,2,2-trichloroethylsulfonylurea.
| Compound Name | 2,2,2-trichloroethylsulfonylurea |
|---|---|
| PubChem CID | 154279468 |
| Molecular Formula | C3H5Cl3N2O3S |
| Molecular Weight | 255.51 g/mol |
| Exact Mass | 253.91 |
| IUPAC Name | 2,2,2-trichloroethylsulfonylurea |
| SMILES | NC(=O)NS(=O)(=O)CC(Cl)(Cl)Cl |
| InChI | InChI=1S/C3H5Cl3N2O3S/c4-3(5,6)1-12(10,11)8-2(7)9/h1H2,(H3,7,8,9) |
| InChIKey | YNFPEXZXJDPQOW-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.51 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|