C10H19NO3S — CID 154807595
N-(2,2-dimethylpropylsulfonyl)-2-methylbut-2-enamide (PubChem CID 154807595) has the molecular formula C10H19NO3S and a molecular weight of 233.33 g/mol. Its IUPAC name is N-(2,2-dimethylpropylsulfonyl)-2-methylbut-2-enamide.
| Compound Name | N-(2,2-dimethylpropylsulfonyl)-2-methylbut-2-enamide |
|---|---|
| PubChem CID | 154807595 |
| Molecular Formula | C10H19NO3S |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | N-(2,2-dimethylpropylsulfonyl)-2-methylbut-2-enamide |
| SMILES | CC=C(C)C(=O)NS(=O)(=O)CC(C)(C)C |
| InChI | InChI=1S/C10H19NO3S/c1-6-8(2)9(12)11-15(13,14)7-10(3,4)5/h6H,7H2,1-5H3,(H,11,12) |
| InChIKey | IQRXCULNJNGEAN-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|