C9H17NO — CID 154292320
1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-2-ol (PubChem CID 154292320) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is 1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-2-ol.
| Compound Name | 1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-2-ol |
|---|---|
| PubChem CID | 154292320 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | 1-methyl-2,3,3a,4,5,6,7,7a-octahydroindol-2-ol |
| SMILES | CN1C(O)CC2CCCCC21 |
| InChI | InChI=1S/C9H17NO/c1-10-8-5-3-2-4-7(8)6-9(10)11/h7-9,11H,2-6H2,1H3 |
| InChIKey | QCNHAIZZSKYVBV-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |