C14H19NO7S2 — CID 154304909
3-[butyl(2-methylprop-2-enoyl)amino]benzene-1,2-disulfonic acid (PubChem CID 154304909) has the molecular formula C14H19NO7S2 and a molecular weight of 377.44 g/mol. Its IUPAC name is 3-[butyl(2-methylprop-2-enoyl)amino]benzene-1,2-disulfonic acid.
| Compound Name | 3-[butyl(2-methylprop-2-enoyl)amino]benzene-1,2-disulfonic acid |
|---|---|
| PubChem CID | 154304909 |
| Molecular Formula | C14H19NO7S2 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | 3-[butyl(2-methylprop-2-enoyl)amino]benzene-1,2-disulfonic acid |
| SMILES | C=C(C)C(=O)N(CCCC)c1cccc(S(=O)(=O)O)c1S(=O)(=O)O |
| InChI | InChI=1S/C14H19NO7S2/c1-4-5-9-15(14(16)10(2)3)11-7-6-8-12(23(17,18)19)13(11)24(20,21)22/h6-8H,2,4-5,9H2,1,3H3,(H,17,18,19)(H,20,21,22) |
| InChIKey | JRAJTBJMOSXKEB-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 129.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|