C13H13N3O3 — CID 154306705
1-(2,1-benzoxazole-3-carbonyl)pyrrolidine-2-carboxamide (PubChem CID 154306705) has the molecular formula C13H13N3O3 and a molecular weight of 259.26 g/mol. Its IUPAC name is 1-(2,1-benzoxazole-3-carbonyl)pyrrolidine-2-carboxamide.
| Compound Name | 1-(2,1-benzoxazole-3-carbonyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 154306705 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 1-(2,1-benzoxazole-3-carbonyl)pyrrolidine-2-carboxamide |
| SMILES | NC(=O)C1CCCN1C(=O)c1onc2ccccc12 |
| InChI | InChI=1S/C13H13N3O3/c14-12(17)10-6-3-7-16(10)13(18)11-8-4-1-2-5-9(8)15-19-11/h1-2,4-5,10H,3,6-7H2,(H2,14,17) |
| InChIKey | VDISWJHJQNKZME-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |