C20H20F3N3O3 — CID 171675416
[(4aR,7aR)-6-[1-(trifluoromethyl)cyclopropanecarbonyl]-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-(2,1-benzoxazol-3-yl)methanone (PubChem CID 171675416) has the molecular formula C20H20F3N3O3 and a molecular weight of 407.39 g/mol. Its IUPAC name is [(4aR,7aR)-6-[1-(trifluoromethyl)cyclopropanecarbonyl]-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-(2,1-benzoxazol-3-yl)methanone.
| Compound Name | [(4aR,7aR)-6-[1-(trifluoromethyl)cyclopropanecarbonyl]-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-(2,1-benzoxazol-3-yl)methanone |
|---|---|
| PubChem CID | 171675416 |
| Molecular Formula | C20H20F3N3O3 |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | [(4aR,7aR)-6-[1-(trifluoromethyl)cyclopropanecarbonyl]-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridin-1-yl]-(2,1-benzoxazol-3-yl)methanone |
| SMILES | O=C(c1onc2ccccc12)N1CCC[C@@H]2CN(C(=O)C3(C(F)(F)F)CC3)C[C@@H]21 |
| InChI | InChI=1S/C20H20F3N3O3/c21-20(22,23)19(7-8-19)18(28)25-10-12-4-3-9-26(15(12)11-25)17(27)16-13-5-1-2-6-14(13)24-29-16/h1-2,5-6,12,15H,3-4,7-11H2/t12-,15+/m1/s1 |
| InChIKey | BRRJKSIXHWAPMV-DOMZBBRYSA-N |
| XLogP | 3.23 |
| TPSA | 66.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |