C11H13N3O2S — CID 154308551
tert-butyl 1H-pyrido[3,2-c][1,2,5]thiadiazine-7-carboxylate (PubChem CID 154308551) has the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. Its IUPAC name is tert-butyl 1H-pyrido[3,2-c][1,2,5]thiadiazine-7-carboxylate.
| Compound Name | tert-butyl 1H-pyrido[3,2-c][1,2,5]thiadiazine-7-carboxylate |
|---|---|
| PubChem CID | 154308551 |
| Molecular Formula | C11H13N3O2S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | tert-butyl 1H-pyrido[3,2-c][1,2,5]thiadiazine-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)c1cnc2c(c1)NSC=N2 |
| InChI | InChI=1S/C11H13N3O2S/c1-11(2,3)16-10(15)7-4-8-9(12-5-7)13-6-17-14-8/h4-6,14H,1-3H3 |
| InChIKey | SPKGDYIDVJIGSI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|