About dichloro(1,4-dioxan-2-yl)borane
dichloro(1,4-dioxan-2-yl)borane (PubChem CID 15430968) has the molecular formula C4H7BCl2O2
and a molecular weight of 168.82 g/mol. Its IUPAC name is dichloro(1,4-dioxan-2-yl)borane.
Molecular Properties
| Compound Name | dichloro(1,4-dioxan-2-yl)borane |
| PubChem CID | 15430968 |
| Molecular Formula | C4H7BCl2O2 |
| Molecular Weight | 168.82 g/mol |
| Exact Mass | 167.99 |
| IUPAC Name | dichloro(1,4-dioxan-2-yl)borane |
| SMILES | ClB(Cl)C1COCCO1 |
| InChI | InChI=1S/C4H7BCl2O2/c6-5(7)4-3-8-1-2-9-4/h4H,1-3H2 |
| InChIKey | UHVQDQWKFKBELH-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.82 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dichloro(1,4-dioxan-2-yl)borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloro(1,4-dioxan-2-yl)borane?
The IUPAC name of dichloro(1,4-dioxan-2-yl)borane (CID 15430968) is dichloro(1,4-dioxan-2-yl)borane.
What is the SMILES notation for dichloro(1,4-dioxan-2-yl)borane?
The canonical SMILES for dichloro(1,4-dioxan-2-yl)borane is ClB(Cl)C1COCCO1.
What is the InChIKey of dichloro(1,4-dioxan-2-yl)borane?
The InChIKey is UHVQDQWKFKBELH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7BCl2O2/c6-5(7)4-3-8-1-2-9-4/h4H,1-3H2.
What are the key properties of dichloro(1,4-dioxan-2-yl)borane?
dichloro(1,4-dioxan-2-yl)borane has a molecular weight of 168.82 g/mol, XLogP of 0.91, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dichloro(1,4-dioxan-2-yl)borane is sourced from PubChem (CID 15430968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).