C9H12N4O6 — CID 154315682
(3R,4S,5R)-2-(4-amino-5-nitropyrimidin-2-yl)-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 154315682) has the molecular formula C9H12N4O6 and a molecular weight of 272.22 g/mol. Its IUPAC name is (3R,4S,5R)-2-(4-amino-5-nitropyrimidin-2-yl)-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (3R,4S,5R)-2-(4-amino-5-nitropyrimidin-2-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 154315682 |
| Molecular Formula | C9H12N4O6 |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | (3R,4S,5R)-2-(4-amino-5-nitropyrimidin-2-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | Nc1nc(C2O[C@H](CO)[C@@H](O)[C@H]2O)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H12N4O6/c10-8-3(13(17)18)1-11-9(12-8)7-6(16)5(15)4(2-14)19-7/h1,4-7,14-16H,2H2,(H2,10,11,12)/t4-,5-,6-,7?/m1/s1 |
| InChIKey | LIZXSDCBVAPORF-RKEPMNIXSA-N |
| XLogP | -1.88 |
| TPSA | 164.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|