C9H12N4O7 — CID 23269148
1-[(2S,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-nitropyrazole-5-carboxamide (PubChem CID 23269148) has the molecular formula C9H12N4O7 and a molecular weight of 288.22 g/mol. Its IUPAC name is 1-[(2S,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-nitropyrazole-5-carboxamide.
| Compound Name | 1-[(2S,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-nitropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 23269148 |
| Molecular Formula | C9H12N4O7 |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 1-[(2S,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-4-nitropyrazole-5-carboxamide |
| SMILES | NC(=O)c1c([N+](=O)[O-])cnn1[C@H]1O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C9H12N4O7/c10-8(17)5-3(13(18)19)1-11-12(5)9-7(16)6(15)4(2-14)20-9/h1,4,6-7,9,14-16H,2H2,(H2,10,17)/t4-,6-,7+,9+/m1/s1 |
| InChIKey | MDEBJFLGSBPOQF-XNEQSKADSA-N |
| XLogP | -2.50 |
| TPSA | 173.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|