C12H14N4O5 — CID 169033139
2-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide (PubChem CID 169033139) has the molecular formula C12H14N4O5 and a molecular weight of 294.27 g/mol. Its IUPAC name is 2-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide.
| Compound Name | 2-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 169033139 |
| Molecular Formula | C12H14N4O5 |
| Molecular Weight | 294.27 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 2-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-7H-pyrrolo[2,3-d]pyrimidine-5-carboxamide |
| SMILES | NC(=O)c1c[nH]c2nc([C@H]3O[C@H](CO)[C@@H](O)[C@H]3O)ncc12 |
| InChI | InChI=1S/C12H14N4O5/c13-10(20)4-1-14-11-5(4)2-15-12(16-11)9-8(19)7(18)6(3-17)21-9/h1-2,6-9,17-19H,3H2,(H2,13,20)(H,14,15,16)/t6-,7-,8-,9+/m1/s1 |
| InChIKey | KJUSOYNDJPRLFU-BGZDPUMWSA-N |
| XLogP | -1.79 |
| TPSA | 154.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.27 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |