C14H16S — CID 154317333
8-ethylsulfanyl-1,2-dimethylnaphthalene (PubChem CID 154317333) has the molecular formula C14H16S and a molecular weight of 216.35 g/mol. Its IUPAC name is 8-ethylsulfanyl-1,2-dimethylnaphthalene.
| Compound Name | 8-ethylsulfanyl-1,2-dimethylnaphthalene |
|---|---|
| PubChem CID | 154317333 |
| Molecular Formula | C14H16S |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 8-ethylsulfanyl-1,2-dimethylnaphthalene |
| SMILES | CCSc1cccc2ccc(C)c(C)c12 |
| InChI | InChI=1S/C14H16S/c1-4-15-13-7-5-6-12-9-8-10(2)11(3)14(12)13/h5-9H,4H2,1-3H3 |
| InChIKey | JXWIUZHHACRNIH-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |