C10H20F3NO2S — CID 154318459
3-[3-(3,3,3-trifluoropropylsulfinyl)propylamino]butan-2-ol (PubChem CID 154318459) has the molecular formula C10H20F3NO2S and a molecular weight of 275.34 g/mol. Its IUPAC name is 3-[3-(3,3,3-trifluoropropylsulfinyl)propylamino]butan-2-ol.
| Compound Name | 3-[3-(3,3,3-trifluoropropylsulfinyl)propylamino]butan-2-ol |
|---|---|
| PubChem CID | 154318459 |
| Molecular Formula | C10H20F3NO2S |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 3-[3-(3,3,3-trifluoropropylsulfinyl)propylamino]butan-2-ol |
| SMILES | CC(O)C(C)NCCCS(=O)CCC(F)(F)F |
| InChI | InChI=1S/C10H20F3NO2S/c1-8(9(2)15)14-5-3-6-17(16)7-4-10(11,12)13/h8-9,14-15H,3-7H2,1-2H3 |
| InChIKey | VSEXEUWBFLRMAF-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|