C9H10N4O — CID 154322034
N-ethyltriazolo[1,5-a]pyridine-5-carboxamide (PubChem CID 154322034) has the molecular formula C9H10N4O and a molecular weight of 190.21 g/mol. Its IUPAC name is N-ethyltriazolo[1,5-a]pyridine-5-carboxamide.
| Compound Name | N-ethyltriazolo[1,5-a]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 154322034 |
| Molecular Formula | C9H10N4O |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | N-ethyltriazolo[1,5-a]pyridine-5-carboxamide |
| SMILES | CCNC(=O)c1ccn2nncc2c1 |
| InChI | InChI=1S/C9H10N4O/c1-2-10-9(14)7-3-4-13-8(5-7)6-11-12-13/h3-6H,2H2,1H3,(H,10,14) |
| InChIKey | YMZWMZYHVPOCDH-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |