C25H34O6 — CID 154323140
2-[(1'S,2'R,7'S,9'R,11'S,12'S,16'S)-2',16'-dimethyl-18'-oxospiro[1,3-dioxolane-2,5'-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadec-14-ene]-15'-yl]ethyl acetate (PubChem CID 154323140) has the molecular formula C25H34O6 and a molecular weight of 430.54 g/mol. Its IUPAC name is 2-[(1'S,2'R,7'S,9'R,11'S,12'S,16'S)-2',16'-dimethyl-18'-oxospiro[1,3-dioxolane-2,5'-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadec-14-ene]-15'-yl]ethyl acetate.
| Compound Name | 2-[(1'S,2'R,7'S,9'R,11'S,12'S,16'S)-2',16'-dimethyl-18'-oxospiro[1,3-dioxolane-2,5'-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadec-14-ene]-15'-yl]ethyl acetate |
|---|---|
| PubChem CID | 154323140 |
| Molecular Formula | C25H34O6 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 2-[(1'S,2'R,7'S,9'R,11'S,12'S,16'S)-2',16'-dimethyl-18'-oxospiro[1,3-dioxolane-2,5'-8-oxapentacyclo[9.7.0.02,7.07,9.012,16]octadec-14-ene]-15'-yl]ethyl acetate |
| SMILES | CC(=O)OCCC1=CC[C@H]2[C@@H]3C[C@H]4O[C@]45CC4(CC[C@]5(C)[C@H]3C(=O)C[C@]12C)OCCO4 |
| InChI | InChI=1S/C25H34O6/c1-15(26)28-9-6-16-4-5-18-17-12-20-25(31-20)14-24(29-10-11-30-24)8-7-23(25,3)21(17)19(27)13-22(16,18)2/h4,17-18,20-21H,5-14H2,1-3H3/t17-,18-,20+,21+,22+,23+,25+/m0/s1 |
| InChIKey | YPEQFVSGTFMEIT-SXJWWZRYSA-N |
| XLogP | 3.57 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|