C9H11BrN2O — CID 154324804
9-bromo-6-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one (PubChem CID 154324804) has the molecular formula C9H11BrN2O and a molecular weight of 243.10 g/mol. Its IUPAC name is 9-bromo-6-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 9-bromo-6-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 154324804 |
| Molecular Formula | C9H11BrN2O |
| Molecular Weight | 243.10 g/mol |
| Exact Mass | 242.01 |
| IUPAC Name | 9-bromo-6-methyl-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one |
| SMILES | CC1CCC(Br)c2nccc(=O)n21 |
| InChI | InChI=1S/C9H11BrN2O/c1-6-2-3-7(10)9-11-5-4-8(13)12(6)9/h4-7H,2-3H2,1H3 |
| InChIKey | GJRKXHRIBVGVRD-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.10 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|