C8H8Br2N2O — CID 163549058
9,9-dibromo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one (PubChem CID 163549058) has the molecular formula C8H8Br2N2O and a molecular weight of 307.97 g/mol. Its IUPAC name is 9,9-dibromo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 9,9-dibromo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 163549058 |
| Molecular Formula | C8H8Br2N2O |
| Molecular Weight | 307.97 g/mol |
| Exact Mass | 305.90 |
| IUPAC Name | 9,9-dibromo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one |
| SMILES | O=c1ccnc2n1CCCC2(Br)Br |
| InChI | InChI=1S/C8H8Br2N2O/c9-8(10)3-1-5-12-6(13)2-4-11-7(8)12/h2,4H,1,3,5H2 |
| InChIKey | FHMHXQNOWKCQAZ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.97 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|