C9H10Br2N2O — CID 13312966
(6R)-9,9-dibromo-6-methyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one (PubChem CID 13312966) has the molecular formula C9H10Br2N2O and a molecular weight of 322.00 g/mol. Its IUPAC name is (6R)-9,9-dibromo-6-methyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one.
| Compound Name | (6R)-9,9-dibromo-6-methyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 13312966 |
| Molecular Formula | C9H10Br2N2O |
| Molecular Weight | 322.00 g/mol |
| Exact Mass | 319.92 |
| IUPAC Name | (6R)-9,9-dibromo-6-methyl-7,8-dihydro-6H-pyrido[1,2-a]pyrimidin-4-one |
| SMILES | C[C@@H]1CCC(Br)(Br)c2nccc(=O)n21 |
| InChI | InChI=1S/C9H10Br2N2O/c1-6-2-4-9(10,11)8-12-5-3-7(14)13(6)8/h3,5-6H,2,4H2,1H3/t6-/m1/s1 |
| InChIKey | YHTRJLYVAGCNAK-ZCFIWIBFSA-N |
| XLogP | 2.54 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.00 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|