C10H9Br2N3O — CID 13312952
9,9-dibromo-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carbonitrile (PubChem CID 13312952) has the molecular formula C10H9Br2N3O and a molecular weight of 347.01 g/mol. Its IUPAC name is 9,9-dibromo-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carbonitrile.
| Compound Name | 9,9-dibromo-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carbonitrile |
|---|---|
| PubChem CID | 13312952 |
| Molecular Formula | C10H9Br2N3O |
| Molecular Weight | 347.01 g/mol |
| Exact Mass | 344.91 |
| IUPAC Name | 9,9-dibromo-6-methyl-4-oxo-7,8-dihydro-6H-pyrido[1,2-a]pyrimidine-3-carbonitrile |
| SMILES | CC1CCC(Br)(Br)c2ncc(C#N)c(=O)n21 |
| InChI | InChI=1S/C10H9Br2N3O/c1-6-2-3-10(11,12)9-14-5-7(4-13)8(16)15(6)9/h5-6H,2-3H2,1H3 |
| InChIKey | WJAMXEPOSKIQNN-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.01 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|