About 2-bromo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one
2-bromo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one (PubChem CID 83823746) has the molecular formula C8H9BrN2O
and a molecular weight of 229.08 g/mol. Its IUPAC name is 2-bromo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one.
Analyze 2-bromo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one?
The IUPAC name of 2-bromo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one (CID 83823746) is 2-bromo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one.
What is the SMILES notation for 2-bromo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one?
The canonical SMILES for 2-bromo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one is O=c1cc(Br)nc2n1CCCC2.
What is the InChIKey of 2-bromo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one?
The InChIKey is QGKZDNPHANGSNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BrN2O/c9-6-5-8(12)11-4-2-1-3-7(11)10-6/h5H,1-4H2.
What are the key properties of 2-bromo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one?
2-bromo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one has a molecular weight of 229.08 g/mol, XLogP of 1.34, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-6,7,8,9-tetrahydropyrido[1,2-a]pyrimidin-4-one is sourced from PubChem (CID 83823746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).