C15H18N4O5 — CID 154333261
1-(1,3-dioxoisoindol-2-yl)ethoxyimino-[3-(hydroxymethyl)pyrrolidin-1-yl]-oxidoazanium (PubChem CID 154333261) has the molecular formula C15H18N4O5 and a molecular weight of 334.33 g/mol. Its IUPAC name is 1-(1,3-dioxoisoindol-2-yl)ethoxyimino-[3-(hydroxymethyl)pyrrolidin-1-yl]-oxidoazanium.
| Compound Name | 1-(1,3-dioxoisoindol-2-yl)ethoxyimino-[3-(hydroxymethyl)pyrrolidin-1-yl]-oxidoazanium |
|---|---|
| PubChem CID | 154333261 |
| Molecular Formula | C15H18N4O5 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 1-(1,3-dioxoisoindol-2-yl)ethoxyimino-[3-(hydroxymethyl)pyrrolidin-1-yl]-oxidoazanium |
| SMILES | CC(ON=[N+]([O-])N1CCC(CO)C1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H18N4O5/c1-10(24-16-19(23)17-7-6-11(8-17)9-20)18-14(21)12-4-2-3-5-13(12)15(18)22/h2-5,10-11,20H,6-9H2,1H3 |
| InChIKey | NGOSFTJCPQABQU-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 108.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|