C13H14N4O5 — CID 118237799
(1,3-dioxoisoindol-2-yl)methoxyimino-[3-(hydroxymethyl)azetidin-1-yl]-oxidoazanium (PubChem CID 118237799) has the molecular formula C13H14N4O5 and a molecular weight of 306.28 g/mol. Its IUPAC name is (1,3-dioxoisoindol-2-yl)methoxyimino-[3-(hydroxymethyl)azetidin-1-yl]-oxidoazanium.
| Compound Name | (1,3-dioxoisoindol-2-yl)methoxyimino-[3-(hydroxymethyl)azetidin-1-yl]-oxidoazanium |
|---|---|
| PubChem CID | 118237799 |
| Molecular Formula | C13H14N4O5 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | (1,3-dioxoisoindol-2-yl)methoxyimino-[3-(hydroxymethyl)azetidin-1-yl]-oxidoazanium |
| SMILES | O=C1c2ccccc2C(=O)N1CON=[N+]([O-])N1CC(CO)C1 |
| InChI | InChI=1S/C13H14N4O5/c18-7-9-5-15(6-9)17(21)14-22-8-16-12(19)10-3-1-2-4-11(10)13(16)20/h1-4,9,18H,5-8H2 |
| InChIKey | WBWSRLZHKKKBHF-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 108.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|