C26H36O4 — CID 154335626
5,8,9,10-tetra(propan-2-yloxy)-1,4-dihydroanthracene (PubChem CID 154335626) has the molecular formula C26H36O4 and a molecular weight of 412.57 g/mol. Its IUPAC name is 5,8,9,10-tetra(propan-2-yloxy)-1,4-dihydroanthracene.
| Compound Name | 5,8,9,10-tetra(propan-2-yloxy)-1,4-dihydroanthracene |
|---|---|
| PubChem CID | 154335626 |
| Molecular Formula | C26H36O4 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | 5,8,9,10-tetra(propan-2-yloxy)-1,4-dihydroanthracene |
| SMILES | CC(C)Oc1ccc(OC(C)C)c2c(OC(C)C)c3c(c(OC(C)C)c12)CC=CC3 |
| InChI | InChI=1S/C26H36O4/c1-15(2)27-21-13-14-22(28-16(3)4)24-23(21)25(29-17(5)6)19-11-9-10-12-20(19)26(24)30-18(7)8/h9-10,13-18H,11-12H2,1-8H3 |
| InChIKey | NSUTWMRVVCJRLT-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|