C24H42N2O2S2 — CID 154345603
1,4-bis(cyclodecylsulfanyl)piperazine-2,5-dione (PubChem CID 154345603) has the molecular formula C24H42N2O2S2 and a molecular weight of 454.75 g/mol. Its IUPAC name is 1,4-bis(cyclodecylsulfanyl)piperazine-2,5-dione.
| Compound Name | 1,4-bis(cyclodecylsulfanyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 154345603 |
| Molecular Formula | C24H42N2O2S2 |
| Molecular Weight | 454.75 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | 1,4-bis(cyclodecylsulfanyl)piperazine-2,5-dione |
| SMILES | O=C1CN(SC2CCCCCCCCC2)C(=O)CN1SC1CCCCCCCCC1 |
| InChI | InChI=1S/C24H42N2O2S2/c27-23-20-26(30-22-17-13-9-5-2-6-10-14-18-22)24(28)19-25(23)29-21-15-11-7-3-1-4-8-12-16-21/h21-22H,1-20H2 |
| InChIKey | KNDQFKSLASGQML-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.75 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|